About N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide
N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide (PubChem CID 135534645) has the molecular formula C2H5N5O3
and a molecular weight of 147.09 g/mol. Its IUPAC name is N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide.
Molecular Properties
| Compound Name | N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide |
| PubChem CID | 135534645 |
| Molecular Formula | C2H5N5O3 |
| Molecular Weight | 147.09 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide |
| SMILES | N/C(=N\[N+](=O)[O-])NNC=O |
| InChI | InChI=1S/C2H5N5O3/c3-2(5-4-1-8)6-7(9)10/h1H,(H,4,8)(H3,3,5,6) |
| InChIKey | WJSQTDWNQAHDHP-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.09 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide?
The IUPAC name of N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide (CID 135534645) is N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide.
What is the SMILES notation for N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide?
The canonical SMILES for N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide is N/C(=N\[N+](=O)[O-])NNC=O.
What is the InChIKey of N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide?
The InChIKey is WJSQTDWNQAHDHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N5O3/c3-2(5-4-1-8)6-7(9)10/h1H,(H,4,8)(H3,3,5,6).
What are the key properties of N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide?
N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide has a molecular weight of 147.09 g/mol, XLogP of -2.26, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(E)-N'-nitrocarbamimidoyl]amino]formamide is sourced from PubChem (CID 135534645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).