C6H9N7O3 — CID 135479862
1-[(E)-1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-2-nitroguanidine (PubChem CID 135479862) has the molecular formula C6H9N7O3 and a molecular weight of 227.18 g/mol. Its IUPAC name is 1-[(E)-1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-2-nitroguanidine.
| Compound Name | 1-[(E)-1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-2-nitroguanidine |
|---|---|
| PubChem CID | 135479862 |
| Molecular Formula | C6H9N7O3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-[(E)-1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-2-nitroguanidine |
| SMILES | C/C(=N\N/C(N)=N\[N+](=O)[O-])c1nonc1C |
| InChI | InChI=1S/C6H9N7O3/c1-3(5-4(2)11-16-12-5)8-9-6(7)10-13(14)15/h1-2H3,(H3,7,9,10)/b8-3+ |
| InChIKey | KHHQPUSZIPGCAA-FPYGCLRLSA-N |
| XLogP | -0.80 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|