C11H9N5O4 — CID 840676
4-methyl-N-[(4-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 840676) has the molecular formula C11H9N5O4 and a molecular weight of 275.22 g/mol. Its IUPAC name is 4-methyl-N-[(4-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-methyl-N-[(4-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 840676 |
| Molecular Formula | C11H9N5O4 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-methyl-N-[(4-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Cc1nonc1C(=O)NN=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H9N5O4/c1-7-10(15-20-14-7)11(17)13-12-6-8-2-4-9(5-3-8)16(18)19/h2-6H,1H3,(H,13,17) |
| InChIKey | PJVZHXMHBHAIOY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|