C11H9IN4O2 — CID 41065971
N-[(Z)-(3-iodophenyl)methylideneamino]-4-methyl-1,2,5-oxadiazole-3-carboxamide (PubChem CID 41065971) has the molecular formula C11H9IN4O2 and a molecular weight of 356.12 g/mol. Its IUPAC name is N-[(Z)-(3-iodophenyl)methylideneamino]-4-methyl-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-[(Z)-(3-iodophenyl)methylideneamino]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 41065971 |
| Molecular Formula | C11H9IN4O2 |
| Molecular Weight | 356.12 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | N-[(Z)-(3-iodophenyl)methylideneamino]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Cc1nonc1C(=O)N/N=C\c1cccc(I)c1 |
| InChI | InChI=1S/C11H9IN4O2/c1-7-10(16-18-15-7)11(17)14-13-6-8-3-2-4-9(12)5-8/h2-6H,1H3,(H,14,17)/b13-6- |
| InChIKey | ZGDDITIUEMOWTA-MLPAPPSSSA-N |
| XLogP | 1.75 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.12 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|