C8H9N5O2S — CID 135498282
2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135498282) has the molecular formula C8H9N5O2S and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135498282 |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(=NN=C1NC(=O)CS1)c1nonc1C |
| InChI | InChI=1S/C8H9N5O2S/c1-4(7-5(2)12-15-13-7)10-11-8-9-6(14)3-16-8/h3H2,1-2H3,(H,9,11,14) |
| InChIKey | MQWIOGLYTGXSTK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|