C10H11N3O4S — CID 162666215
ethyl 4-methyl-2-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]-1,3-oxazole-5-carboxylate (PubChem CID 162666215) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 162666215 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | ethyl 4-methyl-2-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1oc(/N=C2\NC(=O)CS2)nc1C |
| InChI | InChI=1S/C10H11N3O4S/c1-3-16-8(15)7-5(2)11-9(17-7)13-10-12-6(14)4-18-10/h3-4H2,1-2H3,(H,11,12,13,14) |
| InChIKey | DVJMORRUOQJWLL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|