About ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate
ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate (PubChem CID 80538117) has the molecular formula C11H9Br2NO3S
and a molecular weight of 395.07 g/mol. Its IUPAC name is ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate |
| PubChem CID | 80538117 |
| Molecular Formula | C11H9Br2NO3S |
| Molecular Weight | 395.07 g/mol |
| Exact Mass | 392.87 |
| IUPAC Name | ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1oc(-c2cc(Br)c(Br)s2)nc1C |
| InChI | InChI=1S/C11H9Br2NO3S/c1-3-16-11(15)8-5(2)14-10(17-8)7-4-6(12)9(13)18-7/h4H,3H2,1-2H3 |
| InChIKey | QAUKCBAURZZLJR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.07 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate (CID 80538117) is ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate is CCOC(=O)c1oc(-c2cc(Br)c(Br)s2)nc1C.
What is the InChIKey of ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate?
The InChIKey is QAUKCBAURZZLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Br2NO3S/c1-3-16-11(15)8-5(2)14-10(17-8)7-4-6(12)9(13)18-7/h4H,3H2,1-2H3.
What are the key properties of ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate?
ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate has a molecular weight of 395.07 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 80538117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).