C14H13Br2NO3 — CID 114370765
ethyl 2-(2,5-dibromophenyl)-4-ethyl-1,3-oxazole-5-carboxylate (PubChem CID 114370765) has the molecular formula C14H13Br2NO3 and a molecular weight of 403.07 g/mol. Its IUPAC name is ethyl 2-(2,5-dibromophenyl)-4-ethyl-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-(2,5-dibromophenyl)-4-ethyl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 114370765 |
| Molecular Formula | C14H13Br2NO3 |
| Molecular Weight | 403.07 g/mol |
| Exact Mass | 400.93 |
| IUPAC Name | ethyl 2-(2,5-dibromophenyl)-4-ethyl-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1oc(-c2cc(Br)ccc2Br)nc1CC |
| InChI | InChI=1S/C14H13Br2NO3/c1-3-11-12(14(18)19-4-2)20-13(17-11)9-7-8(15)5-6-10(9)16/h5-7H,3-4H2,1-2H3 |
| InChIKey | WWPKUXKOPTZLQW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.07 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |