C12H13NO3S — CID 104842657
ethyl 4-ethyl-2-thiophen-2-yl-1,3-oxazole-5-carboxylate (PubChem CID 104842657) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is ethyl 4-ethyl-2-thiophen-2-yl-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 4-ethyl-2-thiophen-2-yl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 104842657 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | ethyl 4-ethyl-2-thiophen-2-yl-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1oc(-c2cccs2)nc1CC |
| InChI | InChI=1S/C12H13NO3S/c1-3-8-10(12(14)15-4-2)16-11(13-8)9-6-5-7-17-9/h5-7H,3-4H2,1-2H3 |
| InChIKey | NCPSFPJUMZEDQI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |