C14H15NO3S — CID 55517849
(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-pent-2-enoate (PubChem CID 55517849) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-pent-2-enoate.
| Compound Name | (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-pent-2-enoate |
|---|---|
| PubChem CID | 55517849 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCc1nc(-c2cccs2)oc1C |
| InChI | InChI=1S/C14H15NO3S/c1-3-4-7-13(16)17-9-11-10(2)18-14(15-11)12-6-5-8-19-12/h4-8H,3,9H2,1-2H3/b7-4+ |
| InChIKey | YZNJZEVCGCMUMM-QPJJXVBHSA-N |
| XLogP | 3.72 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|