C9H8ClNOS — CID 5076491
4-(chloromethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole (PubChem CID 5076491) has the molecular formula C9H8ClNOS and a molecular weight of 213.69 g/mol. Its IUPAC name is 4-(chloromethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 5076491 |
| Molecular Formula | C9H8ClNOS |
| Molecular Weight | 213.69 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 4-(chloromethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole |
| SMILES | Cc1oc(-c2cccs2)nc1CCl |
| InChI | InChI=1S/C9H8ClNOS/c1-6-7(5-10)11-9(12-6)8-3-2-4-13-8/h2-4H,5H2,1H3 |
| InChIKey | PLUQESCJPNWDFO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|