C13H11NO3S — CID 75416781
prop-2-ynyl 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate (PubChem CID 75416781) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is prop-2-ynyl 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate.
| Compound Name | prop-2-ynyl 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 75416781 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | prop-2-ynyl 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate |
| SMILES | C#CCOC(=O)Cc1nc(-c2cccs2)oc1C |
| InChI | InChI=1S/C13H11NO3S/c1-3-6-16-12(15)8-10-9(2)17-13(14-10)11-5-4-7-18-11/h1,4-5,7H,6,8H2,2H3 |
| InChIKey | GNQXFQJTVXPPDQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|