About [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate
[1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate (PubChem CID 55998676) has the molecular formula C19H17BrN2O4S
and a molecular weight of 449.33 g/mol. Its IUPAC name is [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate.
Molecular Properties
| Compound Name | [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate |
| PubChem CID | 55998676 |
| Molecular Formula | C19H17BrN2O4S |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate |
| SMILES | Cc1oc(-c2cccs2)nc1CC(=O)OC(C)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrN2O4S/c1-11-15(22-19(26-11)16-4-3-9-27-16)10-17(23)25-12(2)18(24)21-14-7-5-13(20)6-8-14/h3-9,12H,10H2,1-2H3,(H,21,24) |
| InChIKey | BVLURCAQQBJMNY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate?
The IUPAC name of [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate (CID 55998676) is [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate.
What is the SMILES notation for [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate?
The canonical SMILES for [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate is Cc1oc(-c2cccs2)nc1CC(=O)OC(C)C(=O)Nc1ccc(Br)cc1.
What is the InChIKey of [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate?
The InChIKey is BVLURCAQQBJMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrN2O4S/c1-11-15(22-19(26-11)16-4-3-9-27-16)10-17(23)25-12(2)18(24)21-14-7-5-13(20)6-8-14/h3-9,12H,10H2,1-2H3,(H,21,24).
What are the key properties of [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate?
[1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate has a molecular weight of 449.33 g/mol, XLogP of 4.59, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromoanilino)-1-oxopropan-2-yl] 2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetate is sourced from PubChem (CID 55998676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).