C7H10N2O3S — CID 137163257
ethyl 2-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]acetate (PubChem CID 137163257) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is ethyl 2-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]acetate.
| Compound Name | ethyl 2-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]acetate |
|---|---|
| PubChem CID | 137163257 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | ethyl 2-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]acetate |
| SMILES | CCOC(=O)C/N=C1/NC(=O)CS1 |
| InChI | InChI=1S/C7H10N2O3S/c1-2-12-6(11)3-8-7-9-5(10)4-13-7/h2-4H2,1H3,(H,8,9,10) |
| InChIKey | VKTLASRHEKHEBT-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|