C7H10N2OS — CID 135990436
2-(cyclopropylmethylimino)-1,3-thiazolidin-4-one (PubChem CID 135990436) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-(cyclopropylmethylimino)-1,3-thiazolidin-4-one.
| Compound Name | 2-(cyclopropylmethylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135990436 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-(cyclopropylmethylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\CC2CC2)N1 |
| InChI | InChI=1S/C7H10N2OS/c10-6-4-11-7(9-6)8-3-5-1-2-5/h5H,1-4H2,(H,8,9,10) |
| InChIKey | CODXKEBITPJCJM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|