About N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide
N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide (PubChem CID 4095460) has the molecular formula C4H4N4O4
and a molecular weight of 172.10 g/mol. Its IUPAC name is N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide |
| PubChem CID | 4095460 |
| Molecular Formula | C4H4N4O4 |
| Molecular Weight | 172.10 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide |
| SMILES | CC(=O)Nc1nonc1[N+](=O)[O-] |
| InChI | InChI=1S/C4H4N4O4/c1-2(9)5-3-4(8(10)11)7-12-6-3/h1H3,(H,5,6,9) |
| InChIKey | SXUQUWWNZIKXBO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.10 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide?
The IUPAC name of N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide (CID 4095460) is N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide.
What is the SMILES notation for N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide?
The canonical SMILES for N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide is CC(=O)Nc1nonc1[N+](=O)[O-].
What is the InChIKey of N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide?
The InChIKey is SXUQUWWNZIKXBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4O4/c1-2(9)5-3-4(8(10)11)7-12-6-3/h1H3,(H,5,6,9).
What are the key properties of N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide?
N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide has a molecular weight of 172.10 g/mol, XLogP of -0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-nitro-1,2,5-oxadiazol-3-yl)acetamide is sourced from PubChem (CID 4095460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).