About N-(4-nitro-1,2-thiazol-5-yl)acetamide
N-(4-nitro-1,2-thiazol-5-yl)acetamide (PubChem CID 10261859) has the molecular formula C5H5N3O3S
and a molecular weight of 187.18 g/mol. Its IUPAC name is N-(4-nitro-1,2-thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-nitro-1,2-thiazol-5-yl)acetamide |
| PubChem CID | 10261859 |
| Molecular Formula | C5H5N3O3S |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | N-(4-nitro-1,2-thiazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1sncc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H5N3O3S/c1-3(9)7-5-4(8(10)11)2-6-12-5/h2H,1H3,(H,7,9) |
| InChIKey | XAIQJNBBVILKCH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-nitro-1,2-thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-nitro-1,2-thiazol-5-yl)acetamide?
The IUPAC name of N-(4-nitro-1,2-thiazol-5-yl)acetamide (CID 10261859) is N-(4-nitro-1,2-thiazol-5-yl)acetamide.
What is the SMILES notation for N-(4-nitro-1,2-thiazol-5-yl)acetamide?
The canonical SMILES for N-(4-nitro-1,2-thiazol-5-yl)acetamide is CC(=O)Nc1sncc1[N+](=O)[O-].
What is the InChIKey of N-(4-nitro-1,2-thiazol-5-yl)acetamide?
The InChIKey is XAIQJNBBVILKCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O3S/c1-3(9)7-5-4(8(10)11)2-6-12-5/h2H,1H3,(H,7,9).
What are the key properties of N-(4-nitro-1,2-thiazol-5-yl)acetamide?
N-(4-nitro-1,2-thiazol-5-yl)acetamide has a molecular weight of 187.18 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-nitro-1,2-thiazol-5-yl)acetamide is sourced from PubChem (CID 10261859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).