C9H7N3O3S — CID 5004315
N-(7-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 5004315) has the molecular formula C9H7N3O3S and a molecular weight of 237.24 g/mol. Its IUPAC name is N-(7-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | N-(7-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5004315 |
| Molecular Formula | C9H7N3O3S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | N-(7-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc2cccc([N+](=O)[O-])c2s1 |
| InChI | InChI=1S/C9H7N3O3S/c1-5(13)10-9-11-6-3-2-4-7(12(14)15)8(6)16-9/h2-4H,1H3,(H,10,11,13) |
| InChIKey | ZSAWZURPOGGWMY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|