C10H8N2O2S — CID 2810227
N-(4-oxo-3,1-benzothiazin-2-yl)acetamide (PubChem CID 2810227) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is N-(4-oxo-3,1-benzothiazin-2-yl)acetamide.
| Compound Name | N-(4-oxo-3,1-benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 2810227 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | N-(4-oxo-3,1-benzothiazin-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc2ccccc2c(=O)s1 |
| InChI | InChI=1S/C10H8N2O2S/c1-6(13)11-10-12-8-5-3-2-4-7(8)9(14)15-10/h2-5H,1H3,(H,11,12,13) |
| InChIKey | DJXXLEZEWGGCJB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |