C9H6N2O2S — CID 14478769
4-oxo-3,1-benzothiazine-2-carboxamide (PubChem CID 14478769) has the molecular formula C9H6N2O2S and a molecular weight of 206.23 g/mol. Its IUPAC name is 4-oxo-3,1-benzothiazine-2-carboxamide.
| Compound Name | 4-oxo-3,1-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 14478769 |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 4-oxo-3,1-benzothiazine-2-carboxamide |
| SMILES | NC(=O)c1nc2ccccc2c(=O)s1 |
| InChI | InChI=1S/C9H6N2O2S/c10-7(12)8-11-6-4-2-1-3-5(6)9(13)14-8/h1-4H,(H2,10,12) |
| InChIKey | GZGCSWIONXVMBH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |