C20H21N7O6S2 — CID 159844200
1-ethyl-3-(7-hydroxy-1,3-benzothiazol-2-yl)urea;1-ethyl-3-(7-hydroxy-6-nitro-1,3-benzothiazol-2-yl)urea (PubChem CID 159844200) has the molecular formula C20H21N7O6S2 and a molecular weight of 519.57 g/mol. Its IUPAC name is 1-ethyl-3-(7-hydroxy-1,3-benzothiazol-2-yl)urea;1-ethyl-3-(7-hydroxy-6-nitro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-ethyl-3-(7-hydroxy-1,3-benzothiazol-2-yl)urea;1-ethyl-3-(7-hydroxy-6-nitro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 159844200 |
| Molecular Formula | C20H21N7O6S2 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 1-ethyl-3-(7-hydroxy-1,3-benzothiazol-2-yl)urea;1-ethyl-3-(7-hydroxy-6-nitro-1,3-benzothiazol-2-yl)urea |
| SMILES | CCNC(=O)Nc1nc2ccc([N+](=O)[O-])c(O)c2s1.CCNC(=O)Nc1nc2cccc(O)c2s1 |
| InChI | InChI=1S/C10H10N4O4S.C10H11N3O2S/c1-2-11-9(16)13-10-12-5-3-4-6(14(17)18)7(15)8(5)19-10;1-2-11-9(15)13-10-12-6-4-3-5-7(14)8(6)16-10/h3-4,15H,2H2,1H3,(H2,11,12,13,16);3-5,14H,2H2,1H3,(H2,11,12,13,15) |
| InChIKey | NPBVCCUXZMSFPZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 191.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|