About 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea
1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea (PubChem CID 141332406) has the molecular formula C16H22N6OSSi
and a molecular weight of 374.55 g/mol. Its IUPAC name is 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea |
| PubChem CID | 141332406 |
| Molecular Formula | C16H22N6OSSi |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2cccc(-c3cn(C[Si](C)(C)C)nn3)c2s1 |
| InChI | InChI=1S/C16H22N6OSSi/c1-5-17-15(23)19-16-18-12-8-6-7-11(14(12)24-16)13-9-22(21-20-13)10-25(2,3)4/h6-9H,5,10H2,1-4H3,(H2,17,18,19,23) |
| InChIKey | BNNGRVWCDZHLTK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea?
The IUPAC name of 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea (CID 141332406) is 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea.
What is the SMILES notation for 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea?
The canonical SMILES for 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea is CCNC(=O)Nc1nc2cccc(-c3cn(C[Si](C)(C)C)nn3)c2s1.
What is the InChIKey of 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea?
The InChIKey is BNNGRVWCDZHLTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N6OSSi/c1-5-17-15(23)19-16-18-12-8-6-7-11(14(12)24-16)13-9-22(21-20-13)10-25(2,3)4/h6-9H,5,10H2,1-4H3,(H2,17,18,19,23).
What are the key properties of 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea?
1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea has a molecular weight of 374.55 g/mol, XLogP of 3.57, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[7-[1-(trimethylsilylmethyl)triazol-4-yl]-1,3-benzothiazol-2-yl]urea is sourced from PubChem (CID 141332406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).