C17H15ClN6OS2 — CID 123377085
N'-[2-(ethylcarbamoylamino)-7-pyridin-2-yl-1,3-benzothiazole-5-carbothioyl]carbamimidoyl chloride (PubChem CID 123377085) has the molecular formula C17H15ClN6OS2 and a molecular weight of 418.94 g/mol. Its IUPAC name is N'-[2-(ethylcarbamoylamino)-7-pyridin-2-yl-1,3-benzothiazole-5-carbothioyl]carbamimidoyl chloride.
| Compound Name | N'-[2-(ethylcarbamoylamino)-7-pyridin-2-yl-1,3-benzothiazole-5-carbothioyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 123377085 |
| Molecular Formula | C17H15ClN6OS2 |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N'-[2-(ethylcarbamoylamino)-7-pyridin-2-yl-1,3-benzothiazole-5-carbothioyl]carbamimidoyl chloride |
| SMILES | CCNC(=O)Nc1nc2cc(C(=S)/N=C(/N)Cl)cc(-c3ccccn3)c2s1 |
| InChI | InChI=1S/C17H15ClN6OS2/c1-2-20-16(25)24-17-22-12-8-9(14(26)23-15(18)19)7-10(13(12)27-17)11-5-3-4-6-21-11/h3-8H,2H2,1H3,(H2,19,23,26)(H2,20,22,24,25) |
| InChIKey | LRRJZEFDBLCNIP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|