C22H17FLiN4O3S — CID 87301041
CID 87301041 (PubChem CID 87301041) has the molecular formula C22H17FLiN4O3S and a molecular weight of 443.41 g/mol.
| Compound Name | CID 87301041 |
|---|---|
| PubChem CID | 87301041 |
| Molecular Formula | C22H17FLiN4O3S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | — |
| SMILES | CCNC(=O)Nc1nc2c(F)c(-c3cccc(C(=O)O)c3)cc(-c3ccccn3)c2s1.[Li] |
| InChI | InChI=1S/C22H17FN4O3S.Li/c1-2-24-21(30)27-22-26-18-17(23)14(12-6-5-7-13(10-12)20(28)29)11-15(19(18)31-22)16-8-3-4-9-25-16;/h3-11H,2H2,1H3,(H,28,29)(H2,24,26,27,30); |
| InChIKey | WDQORSPQHWBGQH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |