C19H22N4O2S — CID 87276227
1-(5-butoxy-7-pyridin-2-yl-1,3-benzothiazol-2-yl)-3-ethylurea (PubChem CID 87276227) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-(5-butoxy-7-pyridin-2-yl-1,3-benzothiazol-2-yl)-3-ethylurea.
| Compound Name | 1-(5-butoxy-7-pyridin-2-yl-1,3-benzothiazol-2-yl)-3-ethylurea |
|---|---|
| PubChem CID | 87276227 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-(5-butoxy-7-pyridin-2-yl-1,3-benzothiazol-2-yl)-3-ethylurea |
| SMILES | CCCCOc1cc(-c2ccccn2)c2sc(NC(=O)NCC)nc2c1 |
| InChI | InChI=1S/C19H22N4O2S/c1-3-5-10-25-13-11-14(15-8-6-7-9-21-15)17-16(12-13)22-19(26-17)23-18(24)20-4-2/h6-9,11-12H,3-5,10H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | AZVIHYLXJIQXHR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|