C22H19BrN5OS+ — CID 123802463
1-[5-(5-bromo-1-azoniabicyclo[5.1.0]octa-1,3,5-trien-3-yl)-7-pyridin-2-yl-1,3-benzothiazol-2-yl]-3-ethylurea (PubChem CID 123802463) has the molecular formula C22H19BrN5OS+ and a molecular weight of 481.40 g/mol. Its IUPAC name is 1-[5-(5-bromo-1-azoniabicyclo[5.1.0]octa-1,3,5-trien-3-yl)-7-pyridin-2-yl-1,3-benzothiazol-2-yl]-3-ethylurea.
| Compound Name | 1-[5-(5-bromo-1-azoniabicyclo[5.1.0]octa-1,3,5-trien-3-yl)-7-pyridin-2-yl-1,3-benzothiazol-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 123802463 |
| Molecular Formula | C22H19BrN5OS+ |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1-[5-(5-bromo-1-azoniabicyclo[5.1.0]octa-1,3,5-trien-3-yl)-7-pyridin-2-yl-1,3-benzothiazol-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2cc(C3=CC(Br)=CC4C[N+]4=C3)cc(-c3ccccn3)c2s1 |
| InChI | InChI=1S/C22H18BrN5OS/c1-2-24-21(29)27-22-26-19-9-13(14-7-15(23)10-16-12-28(16)11-14)8-17(20(19)30-22)18-5-3-4-6-25-18/h3-11,16H,2,12H2,1H3,(H-,24,26,27,29)/p+1 |
| InChIKey | XAJLGVCCMGLOGO-UHFFFAOYSA-O |
| XLogP | 4.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|