C23H24N6O3S — CID 118524409
1-[5-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea (PubChem CID 118524409) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is 1-[5-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[5-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 118524409 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-[5-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea |
| SMILES | CC(C)(O)c1ncc(-c2cc(-c3ccccn3)c3sc(NC(=O)NCCCO)nc3c2)cn1 |
| InChI | InChI=1S/C23H24N6O3S/c1-23(2,32)20-26-12-15(13-27-20)14-10-16(17-6-3-4-7-24-17)19-18(11-14)28-22(33-19)29-21(31)25-8-5-9-30/h3-4,6-7,10-13,30,32H,5,8-9H2,1-2H3,(H2,25,28,29,31) |
| InChIKey | XHOGUUIDPYWYJO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|