C29H32N4O2S — CID 144895411
1-ethyl-3-[5-[4-[(E)-4-methylhex-4-enyl]-3-oxocyclohepta-1,6-dien-1-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]urea (PubChem CID 144895411) has the molecular formula C29H32N4O2S and a molecular weight of 500.67 g/mol. Its IUPAC name is 1-ethyl-3-[5-[4-[(E)-4-methylhex-4-enyl]-3-oxocyclohepta-1,6-dien-1-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[5-[4-[(E)-4-methylhex-4-enyl]-3-oxocyclohepta-1,6-dien-1-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 144895411 |
| Molecular Formula | C29H32N4O2S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-ethyl-3-[5-[4-[(E)-4-methylhex-4-enyl]-3-oxocyclohepta-1,6-dien-1-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]urea |
| SMILES | C/C=C(\C)CCCC1CC=CC(c2cc(-c3ccccn3)c3sc(NC(=O)NCC)nc3c2)=CC1=O |
| InChI | InChI=1S/C29H32N4O2S/c1-4-19(3)10-8-11-20-12-9-13-21(18-26(20)34)22-16-23(24-14-6-7-15-31-24)27-25(17-22)32-29(36-27)33-28(35)30-5-2/h4,6-7,9,13-18,20H,5,8,10-12H2,1-3H3,(H2,30,32,33,35)/b19-4+ |
| InChIKey | LNXSTWIOFWMTSK-RMOCHZDMSA-N |
| XLogP | 7.16 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|