C24H26N4OS — CID 144895438
1-ethyl-3-[5-[(2E,4Z)-6-methylideneocta-2,4-dien-3-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]urea (PubChem CID 144895438) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 1-ethyl-3-[5-[(2E,4Z)-6-methylideneocta-2,4-dien-3-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[5-[(2E,4Z)-6-methylideneocta-2,4-dien-3-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 144895438 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-ethyl-3-[5-[(2E,4Z)-6-methylideneocta-2,4-dien-3-yl]-7-pyridin-2-yl-1,3-benzothiazol-2-yl]urea |
| SMILES | C=C(/C=C\C(=C/C)c1cc(-c2ccccn2)c2sc(NC(=O)NCC)nc2c1)CC |
| InChI | InChI=1S/C24H26N4OS/c1-5-16(4)11-12-17(6-2)18-14-19(20-10-8-9-13-26-20)22-21(15-18)27-24(30-22)28-23(29)25-7-3/h6,8-15H,4-5,7H2,1-3H3,(H2,25,27,28,29)/b12-11-,17-6+ |
| InChIKey | WIPOQQCGTGJNCV-CANLGJSASA-N |
| XLogP | 6.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|