C10H9BIN3OS — CID 87276180
CID 87276180 (PubChem CID 87276180) has the molecular formula C10H9BIN3OS and a molecular weight of 356.99 g/mol.
| Compound Name | CID 87276180 |
|---|---|
| PubChem CID | 87276180 |
| Molecular Formula | C10H9BIN3OS |
| Molecular Weight | 356.99 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | — |
| SMILES | [B]c1cc(I)cc2nc(NC(=O)NCC)sc12 |
| InChI | InChI=1S/C10H9BIN3OS/c1-2-13-9(16)15-10-14-7-4-5(12)3-6(11)8(7)17-10/h3-4H,2H2,1H3,(H2,13,14,15,16) |
| InChIKey | HWADHNOYWSKHME-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.99 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|