C14H15F3N4O5S2 — CID 86664003
[2-(ethylcarbamoylamino)-7-[(Z)-N-methoxy-C-methylcarbonimidoyl]-1,3-benzothiazol-5-yl] trifluoromethanesulfonate (PubChem CID 86664003) has the molecular formula C14H15F3N4O5S2 and a molecular weight of 440.43 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-7-[(Z)-N-methoxy-C-methylcarbonimidoyl]-1,3-benzothiazol-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-(ethylcarbamoylamino)-7-[(Z)-N-methoxy-C-methylcarbonimidoyl]-1,3-benzothiazol-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86664003 |
| Molecular Formula | C14H15F3N4O5S2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | [2-(ethylcarbamoylamino)-7-[(Z)-N-methoxy-C-methylcarbonimidoyl]-1,3-benzothiazol-5-yl] trifluoromethanesulfonate |
| SMILES | CCNC(=O)Nc1nc2cc(OS(=O)(=O)C(F)(F)F)cc(/C(C)=N\OC)c2s1 |
| InChI | InChI=1S/C14H15F3N4O5S2/c1-4-18-12(22)20-13-19-10-6-8(26-28(23,24)14(15,16)17)5-9(11(10)27-13)7(2)21-25-3/h5-6H,4H2,1-3H3,(H2,18,19,20,22)/b21-7- |
| InChIKey | VJEQAKABJGWOBP-YXSASFKJSA-N |
| XLogP | 3.04 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|