C21H23N3O3S — CID 86663999
1-[7-(1-ethoxyethenyl)-5-phenylmethoxy-1,3-benzothiazol-2-yl]-3-ethylurea (PubChem CID 86663999) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[7-(1-ethoxyethenyl)-5-phenylmethoxy-1,3-benzothiazol-2-yl]-3-ethylurea.
| Compound Name | 1-[7-(1-ethoxyethenyl)-5-phenylmethoxy-1,3-benzothiazol-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 86663999 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-[7-(1-ethoxyethenyl)-5-phenylmethoxy-1,3-benzothiazol-2-yl]-3-ethylurea |
| SMILES | C=C(OCC)c1cc(OCc2ccccc2)cc2nc(NC(=O)NCC)sc12 |
| InChI | InChI=1S/C21H23N3O3S/c1-4-22-20(25)24-21-23-18-12-16(27-13-15-9-7-6-8-10-15)11-17(19(18)28-21)14(3)26-5-2/h6-12H,3-5,13H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | RQFQSJLSGLLQLT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|