C11H10F3N3O4S2 — CID 59603077
[2-(ethylcarbamoylamino)-1,3-benzothiazol-5-yl] trifluoromethanesulfonate (PubChem CID 59603077) has the molecular formula C11H10F3N3O4S2 and a molecular weight of 369.35 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-1,3-benzothiazol-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-(ethylcarbamoylamino)-1,3-benzothiazol-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59603077 |
| Molecular Formula | C11H10F3N3O4S2 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | [2-(ethylcarbamoylamino)-1,3-benzothiazol-5-yl] trifluoromethanesulfonate |
| SMILES | CCNC(=O)Nc1nc2cc(OS(=O)(=O)C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C11H10F3N3O4S2/c1-2-15-9(18)17-10-16-7-5-6(3-4-8(7)22-10)21-23(19,20)11(12,13)14/h3-5H,2H2,1H3,(H2,15,16,17,18) |
| InChIKey | XDXSCGZEHJYDGD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|