C14H14N4O2S2 — CID 42633662
1-ethyl-3-[5-(2-methoxy-1,3-thiazol-5-yl)-1,3-benzothiazol-2-yl]urea (PubChem CID 42633662) has the molecular formula C14H14N4O2S2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-ethyl-3-[5-(2-methoxy-1,3-thiazol-5-yl)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[5-(2-methoxy-1,3-thiazol-5-yl)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 42633662 |
| Molecular Formula | C14H14N4O2S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-ethyl-3-[5-(2-methoxy-1,3-thiazol-5-yl)-1,3-benzothiazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2cc(-c3cnc(OC)s3)ccc2s1 |
| InChI | InChI=1S/C14H14N4O2S2/c1-3-15-12(19)18-13-17-9-6-8(4-5-10(9)21-13)11-7-16-14(20-2)22-11/h4-7H,3H2,1-2H3,(H2,15,17,18,19) |
| InChIKey | WDNOXIWYTZTYIJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |