C11H14N4O2S — CID 43551282
1-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylurea (PubChem CID 43551282) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylurea.
| Compound Name | 1-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylurea |
|---|---|
| PubChem CID | 43551282 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2c(OC)cc(N)cc2s1 |
| InChI | InChI=1S/C11H14N4O2S/c1-3-13-10(16)15-11-14-9-7(17-2)4-6(12)5-8(9)18-11/h4-5H,3,12H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | HAVCRRYUKHRNGD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|