C12H18N4O3S2 — CID 114814113
4-methoxy-2-N-(2-methylpropylsulfamoyl)-1,3-benzothiazole-2,6-diamine (PubChem CID 114814113) has the molecular formula C12H18N4O3S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 4-methoxy-2-N-(2-methylpropylsulfamoyl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 4-methoxy-2-N-(2-methylpropylsulfamoyl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 114814113 |
| Molecular Formula | C12H18N4O3S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-methoxy-2-N-(2-methylpropylsulfamoyl)-1,3-benzothiazole-2,6-diamine |
| SMILES | COc1cc(N)cc2sc(NS(=O)(=O)NCC(C)C)nc12 |
| InChI | InChI=1S/C12H18N4O3S2/c1-7(2)6-14-21(17,18)16-12-15-11-9(19-3)4-8(13)5-10(11)20-12/h4-5,7,14H,6,13H2,1-3H3,(H,15,16) |
| InChIKey | PHNHNJRLAHGTEV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|