C10H14N4O3S2 — CID 114804545
2-N-(ethylsulfamoyl)-4-methoxy-1,3-benzothiazole-2,6-diamine (PubChem CID 114804545) has the molecular formula C10H14N4O3S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-N-(ethylsulfamoyl)-4-methoxy-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-(ethylsulfamoyl)-4-methoxy-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 114804545 |
| Molecular Formula | C10H14N4O3S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-N-(ethylsulfamoyl)-4-methoxy-1,3-benzothiazole-2,6-diamine |
| SMILES | CCNS(=O)(=O)Nc1nc2c(OC)cc(N)cc2s1 |
| InChI | InChI=1S/C10H14N4O3S2/c1-3-12-19(15,16)14-10-13-9-7(17-2)4-6(11)5-8(9)18-10/h4-5,12H,3,11H2,1-2H3,(H,13,14) |
| InChIKey | NIRSBGPIKKDDKP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|