C10H11N3O4S2 — CID 114806422
2-(ethylsulfamoylamino)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 114806422) has the molecular formula C10H11N3O4S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-(ethylsulfamoylamino)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-(ethylsulfamoylamino)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 114806422 |
| Molecular Formula | C10H11N3O4S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-(ethylsulfamoylamino)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CCNS(=O)(=O)Nc1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C10H11N3O4S2/c1-2-11-19(16,17)13-10-12-7-4-3-6(9(14)15)5-8(7)18-10/h3-5,11H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | XPSLYWMIDTVMCW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |