C17H14N2O6S2 — CID 108782581
4-[(6-ethoxycarbonyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid (PubChem CID 108782581) has the molecular formula C17H14N2O6S2 and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-[(6-ethoxycarbonyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-[(6-ethoxycarbonyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 108782581 |
| Molecular Formula | C17H14N2O6S2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 4-[(6-ethoxycarbonyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid |
| SMILES | CCOC(=O)c1ccc2nc(NS(=O)(=O)c3ccc(C(=O)O)cc3)sc2c1 |
| InChI | InChI=1S/C17H14N2O6S2/c1-2-25-16(22)11-5-8-13-14(9-11)26-17(18-13)19-27(23,24)12-6-3-10(4-7-12)15(20)21/h3-9H,2H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | JVUTVYZUWSJFBR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |