C16H14N2O4S2 — CID 71362240
4-methyl-3-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid (PubChem CID 71362240) has the molecular formula C16H14N2O4S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-methyl-3-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-methyl-3-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 71362240 |
| Molecular Formula | C16H14N2O4S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4-methyl-3-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc2nc(NS(=O)(=O)c3cc(C(=O)O)ccc3C)sc2c1 |
| InChI | InChI=1S/C16H14N2O4S2/c1-9-3-6-12-13(7-9)23-16(17-12)18-24(21,22)14-8-11(15(19)20)5-4-10(14)2/h3-8H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | XRTMOOHPBKGRJI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |