C13H11N5O2S — CID 104669149
N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)pyridazine-4-carboxamide (PubChem CID 104669149) has the molecular formula C13H11N5O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)pyridazine-4-carboxamide.
| Compound Name | N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104669149 |
| Molecular Formula | C13H11N5O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)pyridazine-4-carboxamide |
| SMILES | COc1cc(N)cc2sc(NC(=O)c3ccnnc3)nc12 |
| InChI | InChI=1S/C13H11N5O2S/c1-20-9-4-8(14)5-10-11(9)17-13(21-10)18-12(19)7-2-3-15-16-6-7/h2-6H,14H2,1H3,(H,17,18,19) |
| InChIKey | UXIWFMMPJVUIGX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|