C8H10ClN5O4 — CID 13062978
N-[5-chloro-6-(2-hydroxyethylamino)-3-nitropyrazin-2-yl]acetamide (PubChem CID 13062978) has the molecular formula C8H10ClN5O4 and a molecular weight of 275.65 g/mol. Its IUPAC name is N-[5-chloro-6-(2-hydroxyethylamino)-3-nitropyrazin-2-yl]acetamide.
| Compound Name | N-[5-chloro-6-(2-hydroxyethylamino)-3-nitropyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 13062978 |
| Molecular Formula | C8H10ClN5O4 |
| Molecular Weight | 275.65 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | N-[5-chloro-6-(2-hydroxyethylamino)-3-nitropyrazin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(NCCO)c(Cl)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClN5O4/c1-4(16)11-7-8(14(17)18)12-5(9)6(13-7)10-2-3-15/h15H,2-3H2,1H3,(H2,10,11,13,16) |
| InChIKey | BELAQKKCCCHCOB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.65 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|