C12H9Cl2N3O3S — CID 118352333
1-[5-[(3,4-dichlorophenyl)methylamino]-4-nitro-1,3-thiazol-2-yl]ethanone (PubChem CID 118352333) has the molecular formula C12H9Cl2N3O3S and a molecular weight of 346.20 g/mol. Its IUPAC name is 1-[5-[(3,4-dichlorophenyl)methylamino]-4-nitro-1,3-thiazol-2-yl]ethanone.
| Compound Name | 1-[5-[(3,4-dichlorophenyl)methylamino]-4-nitro-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 118352333 |
| Molecular Formula | C12H9Cl2N3O3S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 1-[5-[(3,4-dichlorophenyl)methylamino]-4-nitro-1,3-thiazol-2-yl]ethanone |
| SMILES | CC(=O)c1nc([N+](=O)[O-])c(NCc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C12H9Cl2N3O3S/c1-6(18)11-16-10(17(19)20)12(21-11)15-5-7-2-3-8(13)9(14)4-7/h2-4,15H,5H2,1H3 |
| InChIKey | FUFPOFJRUAOXRH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|