About 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid
4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid (PubChem CID 66934353) has the molecular formula C16H16Cl2N4O4
and a molecular weight of 399.23 g/mol. Its IUPAC name is 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid.
Molecular Properties
| Compound Name | 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid |
| PubChem CID | 66934353 |
| Molecular Formula | C16H16Cl2N4O4 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1nc(NCc2ccc(Cl)c(Cl)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16Cl2N4O4/c17-11-4-3-10(8-12(11)18)9-20-14-6-5-13(22(25)26)16(21-14)19-7-1-2-15(23)24/h3-6,8H,1-2,7,9H2,(H,23,24)(H2,19,20,21) |
| InChIKey | ZMNKJOAIALDSGM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid?
The IUPAC name of 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid (CID 66934353) is 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid.
What is the SMILES notation for 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid?
The canonical SMILES for 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid is O=C(O)CCCNc1nc(NCc2ccc(Cl)c(Cl)c2)ccc1[N+](=O)[O-].
What is the InChIKey of 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid?
The InChIKey is ZMNKJOAIALDSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N4O4/c17-11-4-3-10(8-12(11)18)9-20-14-6-5-13(22(25)26)16(21-14)19-7-1-2-15(23)24/h3-6,8H,1-2,7,9H2,(H,23,24)(H2,19,20,21).
What are the key properties of 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid?
4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid has a molecular weight of 399.23 g/mol, XLogP of 4.19, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-[(3,4-dichlorophenyl)methylamino]-3-nitro-2-pyridinyl]amino]butanoic acid is sourced from PubChem (CID 66934353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).