C9H10BrN3O4 — CID 146560512
4-[(6-bromo-3-nitro-2-pyridinyl)amino]butanoic acid (PubChem CID 146560512) has the molecular formula C9H10BrN3O4 and a molecular weight of 304.10 g/mol. Its IUPAC name is 4-[(6-bromo-3-nitro-2-pyridinyl)amino]butanoic acid.
| Compound Name | 4-[(6-bromo-3-nitro-2-pyridinyl)amino]butanoic acid |
|---|---|
| PubChem CID | 146560512 |
| Molecular Formula | C9H10BrN3O4 |
| Molecular Weight | 304.10 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 4-[(6-bromo-3-nitro-2-pyridinyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNc1nc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10BrN3O4/c10-7-4-3-6(13(16)17)9(12-7)11-5-1-2-8(14)15/h3-4H,1-2,5H2,(H,11,12)(H,14,15) |
| InChIKey | QZTFQEAKINIVEP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.10 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|