C13H16N4O7 — CID 141018839
4-[[6-(3-carboxypropylamino)-3-nitro-2-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 141018839) has the molecular formula C13H16N4O7 and a molecular weight of 340.29 g/mol. Its IUPAC name is 4-[[6-(3-carboxypropylamino)-3-nitro-2-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[6-(3-carboxypropylamino)-3-nitro-2-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141018839 |
| Molecular Formula | C13H16N4O7 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-[[6-(3-carboxypropylamino)-3-nitro-2-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCCNc1ccc([N+](=O)[O-])c(NC(=O)CCC(=O)O)n1 |
| InChI | InChI=1S/C13H16N4O7/c18-10(5-6-12(21)22)16-13-8(17(23)24)3-4-9(15-13)14-7-1-2-11(19)20/h3-4H,1-2,5-7H2,(H,19,20)(H,21,22)(H2,14,15,16,18) |
| InChIKey | OPTVMYZDSMYHCM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 171.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|