C17H22FN5O9 — CID 78046914
2-[[1-carboxy-5-[(6-fluoro-3-nitro-2-pyridinyl)amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 78046914) has the molecular formula C17H22FN5O9 and a molecular weight of 459.39 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[(6-fluoro-3-nitro-2-pyridinyl)amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[(6-fluoro-3-nitro-2-pyridinyl)amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 78046914 |
| Molecular Formula | C17H22FN5O9 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[[1-carboxy-5-[(6-fluoro-3-nitro-2-pyridinyl)amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NC(CCCCNc1nc(F)ccc1[N+](=O)[O-])C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H22FN5O9/c18-12-6-5-11(23(31)32)14(22-12)19-8-2-1-3-9(15(26)27)20-17(30)21-10(16(28)29)4-7-13(24)25/h5-6,9-10H,1-4,7-8H2,(H,19,22)(H,24,25)(H,26,27)(H,28,29)(H2,20,21,30) |
| InChIKey | DTWRXZUIGDPJET-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 221.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|