C16H18BrN5O3 — CID 66838435
N-[2-[[6-[(3-bromophenyl)methylamino]-3-nitro-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 66838435) has the molecular formula C16H18BrN5O3 and a molecular weight of 408.26 g/mol. Its IUPAC name is N-[2-[[6-[(3-bromophenyl)methylamino]-3-nitro-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-[(3-bromophenyl)methylamino]-3-nitro-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 66838435 |
| Molecular Formula | C16H18BrN5O3 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N-[2-[[6-[(3-bromophenyl)methylamino]-3-nitro-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(NCc2cccc(Br)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18BrN5O3/c1-11(23)18-7-8-19-16-14(22(24)25)5-6-15(21-16)20-10-12-3-2-4-13(17)9-12/h2-6,9H,7-8,10H2,1H3,(H,18,23)(H2,19,20,21) |
| InChIKey | TVBVBKDXFYNVLI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|