C20H18N4O3 — CID 133409032
N-methyl-3-[[(5-nitro-6-phenyl-2-pyridinyl)amino]methyl]benzamide (PubChem CID 133409032) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-methyl-3-[[(5-nitro-6-phenyl-2-pyridinyl)amino]methyl]benzamide.
| Compound Name | N-methyl-3-[[(5-nitro-6-phenyl-2-pyridinyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 133409032 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-methyl-3-[[(5-nitro-6-phenyl-2-pyridinyl)amino]methyl]benzamide |
| SMILES | CNC(=O)c1cccc(CNc2ccc([N+](=O)[O-])c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H18N4O3/c1-21-20(25)16-9-5-6-14(12-16)13-22-18-11-10-17(24(26)27)19(23-18)15-7-3-2-4-8-15/h2-12H,13H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | BNFKNKIPVRJXGY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|