C20H16N6O2 — CID 133409271
5-nitro-6-phenyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]pyridin-2-amine (PubChem CID 133409271) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 5-nitro-6-phenyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]pyridin-2-amine.
| Compound Name | 5-nitro-6-phenyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 133409271 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 5-nitro-6-phenyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCc2nncn2-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H16N6O2/c27-26(28)17-11-12-18(23-20(17)15-7-3-1-4-8-15)21-13-19-24-22-14-25(19)16-9-5-2-6-10-16/h1-12,14H,13H2,(H,21,23) |
| InChIKey | UYDCKUHVVUYIMG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|